Diethyl malonate-d2 is a deuterium-labeled derivative of diethyl malonate, used primarily as a reference standard in organic synthesis. Its incorporation of two deuterium atoms at the methylene position makes it valuable for isotopic labeling studies and mechanistic investigations in chemical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4303-49-5
Methyl D-prolinate
research compound
(R)-3-Phenylpiperidine
research compound
4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride
pharmaceutical intermediate
4'-tert-Butyl-4-chlorobutyrophenone
research intermediate for butyrophenone derivatives
DIETHYL MALONATE
Pharmaceutical intermediate for barbiturates
diethyl 2,2-dideuteriopropanedioate
IYXGSMUGOJNHAZ-BFWBPSQCSA-N
[2H]C([2H])(C(=O)OCC)C(=O)OCC