[Leu3]-Oxytocin is a synthetic peptide analog of oxytocin, characterized by the substitution of leucine at position 3. It is primarily used as a research compound for studying peptide structure-activity relationships.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4294-11-5
Lysine vasopressin
active pharmaceutical ingredient
N-Acetyloxytocin
active pharmaceutical ingredient
Argiprestocin
hormone regulator
Benzyladenine 9-glucoside
plant growth regulator research
P-Tolylmagnesium Bromide
Grignard reagent for organic synthesis
(2R)-but-3-yn-2-ol
research compound
Pivalic acid-d9
deuterated reference standard
(2S)-1-[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-[(4-hydroxyphenyl)methyl]-13-(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide
FRAJVCQUOFINCU-ALERXTORSA-N
CC(C)C[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N