2,5-Thiophenedicarboxylic acid is a chemical compound featuring a thiophene ring with two carboxylic acid groups. It serves as a building block for organic synthesis, particularly in the production of various organic compounds and materials.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4282-31-9
5-acetylthiophene-2-carboxylic acid
Pharmaceutical intermediate for synthesis
4-Butylbenzoic acid
Building block for organic synthesis
9,9-Dimethyl-9H-fluorene
Building block for organic synthesis
4-bromo-3'-chloro-1,1'-biphenyl
Building block for organic synthesis
4-Bromodibenzothiophene
Building block for organic synthesis
2,5-dimethyl furan-2,5-dicarboxylate
Building block for polymer synthesis
Tetrabutylammonium fluoride
Phase-transfer catalyst and organic synthesis reagent
Tripropylene glycol diacrylate
UV-curable coatings and inks monomer
thiophene-2,5-dicarboxylic acid
YCGAZNXXGKTASZ-UHFFFAOYSA-N
C1=C(SC(=C1)C(=O)O)C(=O)O