1,2-Dihydro Dexamethasone is a steroidal compound that serves as an active pharmaceutical ingredient. Its structure features a fused four-ring steroid framework with multiple hydroxyl groups and a fluorine atom, contributing to its chemical properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 426-17-5
Alpha-Cyclopentylmandelic acid
Glycopyrrolate related compound C reference standard
Siproteron asetat
active pharmaceutical ingredient
Flumequine
fluoroquinolone antibiotic
Bevantolol hydrochloride
active pharmaceutical ingredient
FLUDROCORTISONE ACETATE
active pharmaceutical ingredient
Fluorogestone acetate
progestational hormone
(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
YYZXYYHUGHQGHI-CXSFZGCWSA-N
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C