Perflubron is a perfluorocarbon-based haloalkane, specifically a bromine-substituted perfluorooctane, that serves as both a contrast agent for medical imaging and a synthetic blood substitute. Its key significance lies in its ability to carry oxygen and provide radioopacity, making it useful in diverse medical applications such as retinal detachment surgery and cell culture oxygen supply.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 423-55-2
1,2,3,4-Tetramethylcyclopentadiene
precursor for cyclopentadienyl ligands
Methyltriacetoxysilane
cross-linker for silicone sealants and adhesives
4,4-Dimethylcyclohexanone
chemical research intermediate
1,3,5-Triazine, 2-(2-(4-methoxyphenyl)ethenyl)-4,6-bis(trichloromethyl)-
Photoinitiator for UV-curable coatings
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane
WTWWXOGTJWMJHI-UHFFFAOYSA-N
C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F