This compound is a deuterium-labeled aniline derivative, specifically the pentadeuterio form of aniline, where all five aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of isotopically labeled compounds for research and development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4165-61-1
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
2,4-Dichlorothiazole
Pharmaceutical intermediate
ANILINE
chemical intermediate for dyes and polymers
(2H7)Aniline
Deuterated research reagent
2,3,4,5,6-pentadeuterioaniline
PAYRUJLWNCNPSJ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N)[2H])[2H]