Cromophtal yellow AGR is an anthraquinone-based pigment used primarily in ink and coating formulations. Its molecular structure features multiple aromatic rings and amine groups, contributing to its color properties and stability.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4118-16-5
Acid Violet 17
acid dye for textiles
4-Methoxy-2-methyldiphenylamine
Intermediate for thermal and pressure sensitive dyes
N-Methyl-4-nitrophthalimide
speciality pigment intermediate
2-Naphthalenecarboxamide, N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-
Naphthol AS dye coupling component
1-[[4-[(9,10-dioxoanthracen-1-yl)amino]-6-phenyl-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione
MVIFQPPFCHUSIH-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=NC(=NC(=N2)NC3=CC=CC4=C3C(=O)C5=CC=CC=C5C4=O)NC6=CC=CC7=C6C(=O)C8=CC=CC=C8C7=O