Trideuteriomethoxybenzene is a deuterated research standard, where the methoxy group contains three deuterium atoms. It is used as a labeled compound in analytical chemistry and mass spectrometry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4019-63-0
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-(Trifluoromethyl)benzyl bromide
research compound
5-Methyl-1H-pyrazole-3-carboxylic acid
research compound
6-Fluoropyridine-2-carboxylic acid
Research compound
Anisol
solvent and heat transfer medium
trideuteriomethoxybenzene
RDOXTESZEPMUJZ-FIBGUPNXSA-N
[2H]C([2H])([2H])OC1=CC=CC=C1