(4-Benzamidophenyl)boronic acid is a boronic acid derivative used as a pharmaceutical intermediate. Its structure features an amide-linked benzamide group attached to a phenylboronic acid moiety, making it a key building block in the synthesis of boronic acid-containing compounds for research and manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 397843-80-0
N-(4-(BENZOYLAMINO)PHENYL)BENZAMIDE
research compound
(4-Cyanonaphthalen-1-yl)boronic acid
Pharmaceutical intermediate for boronic acid synthesis
6-Benzyloxypyridine-3-boronic acid
Pharmaceutical intermediate for boronic acid synthesis
(2-BOC-AMINOPHENYL)BORONIC ACID
Pharmaceutical intermediate for boronic acid synthesis
4-(Tetrahydro-2H-pyran-2-yloxy)phenylboronic Acid (contains varying amounts of Anhydride)
Pharmaceutical intermediate for boronic acid synthesis
L-Alanine isopropyl ester hydrochloride
amino acid ester intermediate
Tert-butyl 3-oxoazetidine-1-carboxylate
Pharmaceutical intermediate
(6-fluoropyridin-3-yl)methanol
Pharmaceutical intermediate for anxiolytic synthesis
(4-benzamidophenyl)boronic acid
FWZVIUZIYYIKRK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2)(O)O
—