Dimethyl 2-(tert-butyl)malonate is a chemical compound used primarily as a research reagent. Its structure features two ester groups, contributing to its moderate polarity and non-aromatic character.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39520-25-7
Asperosaponin VI
research compound
1,3-Benzenedimethanol, 5,5'-(1-methylethylidene)bis[2-hydroxy-
Research compound for organic synthesis
3-Nitrobenzyl bromide
Organic synthesis reagent
2-Nitrobenzyl bromide
chemical synthesis intermediate
dimethyl 2-tert-butylpropanedioate
OBANUQSDPDUGSL-UHFFFAOYSA-N
CC(C)(C)C(C(=O)OC)C(=O)OC