This compound is a polyether amine used primarily as an intermediate in the production of polyurethane. It features multiple ether linkages and a single amine group, contributing to its role in polymer synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39423-51-3
8-Methoxy-8-oxooctanoic acid
chemical intermediate for synthesis
AX 71
surfactant or emulsifier
2-methoxyethyl 2-[(3-nitrophenyl)methylene]acetoacetate
Chemical intermediate for synthesis
Tetrabromothiophene
organic synthesis intermediate
1-[2,2-bis(2-methylpropoxymethyl)butoxy]propan-2-amine
SRYMBUMLIMKZJO-UHFFFAOYSA-N
CCC(COCC(C)C)(COCC(C)C)COCC(C)N
—