1,3-Adamantanedicarboxylic acid is a dicarboxylic acid derivative of adamantane used as a pharmaceutical intermediate. Its structure features two carboxylic acid groups on the adamantane cage, contributing to its utility in the synthesis of specialty chemicals.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39269-10-8
3-Hydroxyadamantane-1-carboxylic acid
pharmaceutical intermediate
4-amino-2-(trifluoromethyl)benzoic Acid
Pharmaceutical intermediate for synthesis
4-Nitro-3-(trifluoromethyl)aniline
Metabolite of flutamide
5-amino-2-methoxybenzotrifluoride
Pharmaceutical intermediate
5-Bromo-2-fluorobenzotrifluoride
Pharmaceutical intermediate
adamantane-1,3-dicarboxylic acid
PAVQGHWQOQZQEH-UHFFFAOYSA-N
C1C2CC3(CC1CC(C2)(C3)C(=O)O)C(=O)O