3,4-Diaminobenzophenone is a chemical compound used as a pharmaceutical intermediate. It features a benzophenone core with two amine substituents, contributing to its role in the synthesis of active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39070-63-8
Thiomorpholine 1,1-dioxide
Pharmaceutical intermediate
3-Pyridinecarbonitrile, 1-butyl-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-
pharmaceutical intermediate
3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid
Pharmaceutical intermediate for cobimetinib
O-(2-(Vinyloxy)ethyl)hydroxylamine
Pharmaceutical intermediate for binimetinib synthesis
(3,4-diaminophenyl)-phenylmethanone
RXCOGDYOZQGGMK-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N