2,9-Dibromo-1,10-phenanthroline is a brominated heterocyclic compound used as a ligand in coordination chemistry. Its structure features two bromine atoms at the 2 and 9 positions of the phenanthroline core, providing distinct electronic and steric properties for metal complex formation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
2,9-DIBROMO-1,10-PHENANTHROLINE satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
1,2,3-trichlorobenzene-d3
deuterated analytical reference standard
2-Bromopropane-d7
Deuterated research standard
2-Thiopheneacetyl chloride
chemical intermediate for organic synthesis
N-Methyl-L-alanine
research compound
(PHEN)NIBR2
ligand coordinated nickel complex
2,9-dibromo-1,10-phenanthroline
QNLGXYVSHITTGT-UHFFFAOYSA-N
C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br
—
2,9-DIBROMO-1,10-PHENANTHROLINE satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.