This compound is a protected glutamic acid derivative, specifically a Cbz- and tert-butyl ester-protected amino acid used as a building block in peptide synthesis. It features benzyloxycarbonyl (Cbz) protection on the amino group and tert-butyl ester protection on both carboxyl groups, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3886-08-6
L-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(phenylmethyl) ester
Boc-protected glutamic acid intermediate
N-Boc-D-glutamic acid 5-benzyl ester
peptide synthesis protecting group intermediate
5-benzyl 1-(tert-butyl) ((benzyloxy)carbonyl)-L-glutamate
Protected glutamic acid derivative
Z-GLU(OME)-OH
peptide synthesis intermediate
7-dehydrocholesterol-d7
deuterated research compound
Methyl quinoline-6-carboxylate
research compound
Cyclohexylphenylacetonitrile
Research chemical intermediate
3-ACETYL-5-BROMOPYRIDINE
research compound
(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid
GLMODRZPPBZPPB-ZDUSSCGKSA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1