2-Fluoro-6-nitrobenzoic acid is a research compound with a structure featuring a carboxylic acid group, a fluorine atom, and a nitro group on an aromatic ring. Its physicochemical profile suggests moderate lipophilicity and a single hydrogen bond donor, indicating potential as a building block in synthetic chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 385-02-4
Methylamine-15N hydrochloride
Isotopically labeled research compound
2-Mercaptopyrazine
research compound
(1,2,3,4,5,6,7,8-2H8)-9H-carbazole
isotope-labeled research compound
2-NITRODIPHENYL-D9
deuterated analytical reference standard
2-fluoro-6-nitrobenzoic acid
MPDZCNPDHUUPRL-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)O)[N+](=O)[O-]