L-Aspartic acid-2,3,3-d3 is a deuterium-labeled form of the amino acid L-aspartic acid, where three hydrogen atoms are replaced with deuterium. It is primarily used as an isotopically labeled research reagent in biochemical and analytical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3842-25-9
DL-Aspartic acid-d3
deuterated amino acid research reagent
Propanoic acid-2,2-d2
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
D-Pipercolic acid HCl
research compound
Cy-vBRIDP
phosphine ligand for homogeneous catalysis
Bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylethenyl)phosphine
phosphine ligand for catalysis
(2S)-2-amino-2,3,3-trideuteriobutanedioic acid
CKLJMWTZIZZHCS-RBXBQAPRSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)N