This compound is a chemical compound used as a high-performance polymer precursor. Its structure features multiple aromatic rings and ester groups, contributing to its utility in advanced material applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 38103-06-9
Potasyum klorat
Oxidizing agent for matches and explosives
Benzenesulfonic acid, 4-chloro-3,5-dinitro-, potassium salt
sulfonate salt intermediate for dyes
3,3,3-trifluoro-2-(trifluoromethyl)prop-1-ene
monomer for heat-stable copolymers
2,2,3,4,4,4-Hexafluorobutan-1-ol
fluorinated alcohol building block
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-benzofuran-1,3-dione
MQAHXEQUBNDFGI-UHFFFAOYSA-N
CC(C)(C1=CC=C(C=C1)OC2=CC3=C(C=C2)C(=O)OC3=O)C4=CC=C(C=C4)OC5=CC6=C(C=C5)C(=O)OC6=O