This compound is a deuterated derivative of naphthalene, specifically labeled with deuterium atoms at multiple positions including a trideuteriomethyl group. It is primarily used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 38072-94-5
Cyclopentanone-2,2,5,5-d4
Deuterated NMR reference standard
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
Deuterated NMR reference standard
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
Diethylaminosulfur trifluoride
fluorinating reagent for organofluorine synthesis
Diethyl ((4-(3-fluorophenyl)-2-pyridyl)methyl) phosphonate
research compound
Phenylzinc bromide
organometallic reagent for cross-coupling
1-METHYLNAPHTHALENE
Solvent and chemical intermediate
1,2,3,4,5,6,7-heptadeuterio-8-(trideuteriomethyl)naphthalene
QPUYECUOLPXSFR-UZHHFJDZSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H]