3,5-Dichloro-4-methoxybenzoic acid is a chemical compound used as an intermediate in the synthesis of the pharmaceutical agent dotinurad. It features a benzoic acid core substituted with chlorine and methoxy groups, contributing to its role in active pharmaceutical ingredient manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 37908-97-7
3-Bromomethylbenzisoxazole
pharmaceutical intermediate
Phenyl hydrogen ((((R)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonate
Phosphonate intermediate for antiviral prodrugs
5-Methyl-3,4-diphenyl-isoxazole
Pharmaceutical intermediate for parecoxib
4-phenoxyphthalic acid
pharmaceutical intermediate
3,5-dichloro-4-methoxybenzoic acid
XSYZTYQXKIXPRC-UHFFFAOYSA-N
COC1=C(C=C(C=C1Cl)C(=O)O)Cl