2-(Methoxycarbonyl)benzeneboronic acid is a boronic acid derivative used primarily as a research reagent in organic synthesis. It functions as a coupling partner in Suzuki cross-coupling reactions, enabling the formation of carbon-carbon bonds in complex molecular structures.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 374538-03-1
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
4-tert-Butoxyphenylboronic acid
Suzuki coupling reagent
Pyridine-2-boronic acid, pinacol ester
Suzuki coupling reagent
Nbi 31772
insulin-like growth factor binding protein inhibitor
2-chloro-3-fluoro-6-methylpyridine
research compound
6-Bromo-3-fluoro-2-methylpyridine
Pharmaceutical research compound
Kisspeptin-10 (human)
research peptide for GPR54 ligand studies
(2-methoxycarbonylphenyl)boronic acid
ODAXNYMENLFYMY-UHFFFAOYSA-N
B(C1=CC=CC=C1C(=O)OC)(O)O