2-Phenylethyl methacrylate is an industrial chemical primarily used as a monomer for polymer synthesis. It features an aromatic ring and an ester functional group, contributing to its utility in creating specialized polymers.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3683-12-3
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
1-ADAMANTYL METHACRYLATE
Monomer for polymer synthesis
Gamma-butyrolactone methacrylate
Monomer for polymer synthesis
Phenyl methacrylate
Monomer for polymer synthesis
Benzenamine, ar-nonyl-N-(nonylphenyl)-
Antioxidant and lubricating additive
[4,5'-Biisobenzofuran]-1,1',3,3'-tetrone
monomer for polyimide synthesis
1-(2-Hydroxyethyl)imidazolidin-2-one
monomer for polymer production
[2,3,4,5-tetrabromo-6-(hydroxymethyl)phenyl]methanol
Perbrominated aromatic alcohol intermediate
2-phenylethyl 2-methylprop-2-enoate
ILZXXGLGJZQLTR-UHFFFAOYSA-N
CC(=C)C(=O)OCCC1=CC=CC=C1