Arginine ethyl ester hydrochloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients. It is the hydrochloride salt form of L-arginine ethyl ester, a derivative of the amino acid arginine.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 36589-29-4
Cis-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine
Pharmaceutical intermediate for chiral synthesis
Ethyl (1S,3R,4R)-3-{[(tert-butoxy)carbonyl]amino}-4-hydroxycyclohexane-1-carboxylate
Pharmaceutical intermediate for drug synthesis
1,1-Dimethylethyl N-[(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate
Pharmaceutical intermediate for edoxaban synthesis
3-Fluoro-4-methoxyaniline
pharmaceutical intermediate
ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride
DUCUWLZKZPQJDY-RGMNGODLSA-N
CCOC(=O)[C@H](CCCN=C(N)N)N.Cl