2,4,6-Trimethylphenol-d11 is a deuterated analytical reference standard used primarily in research and analytical chemistry for quantitative analysis and method development. Its structure includes a phenolic ring with three trideuteriomethyl groups and deuterium atoms at specific positions, ensuring high isotopic purity for reliable tracing in mass spectrometry and other analytical techniques.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 362049-45-4
2,3,5-TRIMETHYLPHENOL-D11
Deuterated research reagent
Methyl Paraben-d4
deuterated internal standard for analysis
D-Phenylalanine-d5
deuterated amino acid research reagent
1,3-Dioxolan-2-one-d4
deuterated research compound
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)phenol
BPRYUXCVCCNUFE-JXCHDVSKSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]