This compound is a chlorinated heterocyclic ester used as a pharmaceutical intermediate in the synthesis of nucleoside analogs. Its structure features multiple aromatic rings, ester linkages, and halogen substituents, contributing to its role in specialized organic synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3601-90-9
Hoffer's chlorosugar
intermediate for nucleoside synthesis
1-Chloro-3,5-di-O-toluoyl-2-deoxy-D-ribofuranose
Nucleoside synthesis intermediate
1,2-O-(1-methylethylidene)-4-C-[(phenylmethoxy)methyl]-3-O-(phenylmethyl)-L-Lyxofuranose
Pharmaceutical intermediate for nucleoside synthesis
((3aR,4R,6R,6aR)-2,2-Dimethyl-6-(2-oxo-4-(1H-1,2,4-triazol-1-yl)pyrimidin-1(2H)-yl)tetrahydro-2H-furo(3,4-d)(1,3)dioxol-4-yl)methyl 2-methylpropanoate
Pharmaceutical intermediate for nucleoside synthesis
N-Benzoyl-2'-deoxyadenosine
Pharmaceutical intermediate for nucleoside synthesis
Tert-Butyl N-hydroxycarbamate
pharmaceutical intermediate
Methyl 6-aminonicotinate
Pharmaceutical intermediate for drug synthesis
Methyl 6-aminopyridine-2-carboxylate
Pharmaceutical intermediate
[(2R,3S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate
QEHCZULNFYDPPL-RTKIROINSA-N
C1[C@@H]([C@H](OC1Cl)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl