FMOC-PHE (Fmoc-phenylalanine) is an Fmoc-protected amino acid used primarily as a research reagent for the formation of hydrogels. Its self-assembly properties enable the creation of structured peptide-based gel networks in aqueous conditions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 35661-40-6
FMOC-PHE(4-NH2)-OH
Peptide building block intermediate
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)acetic acid
peptide synthesis reagent
4-iodo-3-nitrobenzoic acid
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
3,6-difluoropyrazine-2-carbonitrile
Research compound
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid
Fmoc-protected amino acid reagent
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid
SJVFAHZPLIXNDH-QFIPXVFZSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24