2,5-bis(2,2,2-trifluoroethoxy)benzoic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of flecainide. It features a benzoic acid core with two trifluoroethoxy substituents, contributing to its role in pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 35480-52-5
1-(2,5-bis(2,2,2-trifluoroethoxy)phenyl)ethanone
intermediate for agrochemical or pharmaceutical synthesis
2,2,2-trifluoroethyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate
research compound
Methyl 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide
pharmaceutical intermediate
2-Propenoic acid, 2-phosphonoxy-, tricyclohexylammonium salt
Phosphoenolpyruvate salt for biochemical research
N-Methyl-D-glucamine Hydrochloride
pharmaceutical intermediate
3-Chloro-1,1-diethoxypropane
pharmaceutical intermediate
2,5-bis(2,2,2-trifluoroethoxy)benzoic acid
YPGYLCZBZKRYQJ-UHFFFAOYSA-N
C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)OCC(F)(F)F