1-Chloroadamantane-d15 is a deuterated research compound where all hydrogen atoms in the adamantane structure are replaced with deuterium. It is primarily used as a labeled reagent in analytical and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 352431-55-1
3-(2-Bromo-4,5-dimethoxyphenyl)propanenitrile
research compound
(2-Mercaptophenyl)boronic acid
research compound
3-Chloro-2-fluorophenylboronic acid
Research reagent for organic synthesis
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid
Building block for peptide synthesis
1-Chloroadamantane
pharmaceutical intermediate for amantadine synthesis
1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane
OZNXTQSXSHODFR-BXSQCBKHSA-N
[2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])Cl)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H]