1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic Acid is a boron-containing heterocyclic compound used as a research reagent. Its structure features a pyrazole ring with a trifluoromethyl group and a boronic acid moiety, making it suitable for organic synthesis and medicinal chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 344591-91-9
4-(Methylthio)benzaldehyde
Research compound
3-acetamido-2-hydroxy-4-phenylbutanoic acid
research compound
2-Amino-6-(trifluoromethyl)pyridine
research compound
5-Fluorosalicylic acid
research compound
[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid
XPUNXPPXMANQGF-UHFFFAOYSA-N
B(C1=CC(=NN1C)C(F)(F)F)(O)O