This compound is a salt-like iodonium-based chemical used as a pharmaceutical intermediate. It consists of an aromatic cation paired with a hexafluorophosphate anion.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 344562-80-7
3-(4-fluorophenyl)pentanedioic acid
Pharmaceutical intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
2-Chloro-5-fluoronitrobenzene
Pharmaceutical intermediate
2-Fluorobenzyl chloride
Pharmaceutical intermediate
Bis(p-tolyl)iodonium hexafluorophosphate
cationic photoinitiator
Diphenyliodonium nitrate
laboratory research reagent
2-(Phenyliodonio)benzoate hydrate
Pharmaceutical intermediate
Di(4-t-butylphenyl)iodonium camphorsulfonate
photoacid generator reagent
(4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium hexafluorophosphate
YNDYCGZWQZEBCS-UHFFFAOYSA-N
CC1=CC=C(C=C1)[I+]C2=CC=C(C=C2)CC(C)C.F[P-](F)(F)(F)(F)F