This compound is a deuterated research compound, specifically a decadeuterated dimethoxycyclohexane derivative. It is primarily used as a labeled reagent in laboratory research, where the incorporation of deuterium atoms facilitates studies in metabolic tracing and analytical chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 340257-57-0
Tryptamine-d4 Hydrochloride
labeled research reference standard
3-Methyl-5-isoxazolecarboxylic acid
research compound
Oxazole, 2,2'-(1,3-phenylene)bis[4,5-dihydro-
chemical research intermediate
(S)-1-N-Cbz-prolinamide
Protected proline derivative for peptide synthesis
1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane
MQTLTQMOALIWRO-UPEVGZBISA-N
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])OC)([2H])[2H])([2H])OC)([2H])[2H])[2H]
—