Methyl (2R,3S)-N-benzoylphenylisoserinate is a pharmaceutical intermediate specifically used in the manufacturing process of the taxol side chain. This compound features a complex aromatic structure with alcohol and amide functional groups.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 32981-85-4
Ethyl (I+-R,I2S)-I2-(benzoylamino)-I+--hydroxybenzenepropanoate
pharmaceutical intermediate synthesis
10-Deacetylbaccatin III
Precursor to anti-cancer drug docetaxel
(1S)-2-chloro-1-(2,4-difluorophenyl)ethanol
pharmaceutical intermediate
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
1-(triphenylmethyl)-1H-imidazole-4-carbaldehyde
pharmaceutical intermediate
(2R,3S)-N-Benzoyl-3-phenylisoserine
Pharmaceutical intermediate for taxol synthesis
4-[[(5-Fluoro-2-methoxybenzoyl)amino]methyl]benzoic acid
Pirtobrutinib intermediate
N-(4-(2,2-Dicyano-1-hydroxyvinyl)benzyl)-5-fluoro-2-methoxybenzamide
Pharmaceutical intermediate
methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate
UYJLJICUXJPKTB-LSDHHAIUSA-N
COC(=O)[C@@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O