This compound is a benzimidazole derivative used primarily as a research compound. Its structure includes an amide and an amine functional group, contributing to its properties as a laboratory reagent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 328543-09-5
Benzeneacetic acid, 4-(trifluoromethyl)-
research compound
Benzylamine hydrochloride
pharmaceutical research intermediate
Diphenyl[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine oxide
research compound
(4-(2-(Azepan-1-yl)ethoxy)phenyl)methanol hydrochloride
Research compound
2-[4-[(dimethylamino)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one
SEKJSSBJKFLZIT-UHFFFAOYSA-N
CN(C)CC1=CC=C(C=C1)C2=NC3=CC=CC4=C3N2CCNC4=O