Boc-L-serine is a protected amino acid used in peptide synthesis. It is a white, water-soluble solid derived from serine, featuring a tert-butoxycarbonyl (Boc) protecting group on the amino group and a free carboxylic acid.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3262-72-4
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
research compound
Boc-Ser-Otbu
amino acid protecting group intermediate
Boc-His(Trt)-OH, Nalpha-Boc-N(im)-trityl-L-histidine
protected amino acid for peptide synthesis
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
Triphenylboroxin
Pharmaceutical intermediate
(-)-Di-p-toluoyl-L-tartaric acid
chiral resolving agent for pharmaceuticals
(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
FHOAKXBXYSJBGX-YFKPBYRVSA-N
CC(C)(C)OC(=O)N[C@@H](CO)C(=O)O