1,2-Difluoro-4-(trifluoromethyl)benzene is a fluorinated aromatic compound used primarily as an industrial chemical intermediate. Its structure features a benzene ring substituted with two fluorine atoms and a trifluoromethyl group, contributing to its hydrophobic and stable properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 32137-19-2
Magnesium 2-methylpropan-2-olate
Base in organic synthesis
Cyclohexane, 1-isocyanato-4-methyl-, trans-
aliphatic isocyanate monomer
(3,4-Dichlorophenyl)acetonitrile
chemical intermediate
N-Phenyl-[1,1'-biphenyl]-4-amine
industrial chemical intermediate
1,2-difluoro-4-(trifluoromethyl)benzene
MVCGQTYWLZSKSB-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)F)F