2-Propenoic acid, 2-methyl-, 4-hydroxyphenyl ester is an organic compound consisting of a methacrylate ester linked to a hydroxyphenyl group. It serves as a monomer for polymer synthesis, enabling the production of functionalized polymers.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 31480-93-0
Decyl methacrylate
monomer for polymer synthesis
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
BENZYL METHACRYLATE
monomer for polymer synthesis
2-Propenoic acid, 2-methyl-, 1-ethylcyclopentyl ester (9CI, ACI)
monomer for polymer synthesis
Methyl 4-chlorobutyrate
chemical intermediate for synthesis
2,4-Dibromotoluene
organic synthesis intermediate
Neodecanoic acid, sodium salt
Surfactant and lubricant additive
Tris(2,4-di-tert-butylphenyl) phosphite
antioxidant for plastics
(4-hydroxyphenyl) 2-methylprop-2-enoate
PJMXUSNWBKGQEZ-UHFFFAOYSA-N
CC(=C)C(=O)OC1=CC=C(C=C1)O