This compound is a polycyclic research reagent containing a triazatetracyclic framework with an ester functional group. It is characterized by a moderate lipophilicity and a single hydrogen bond donor, reflecting its potential utility in laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 313544-31-9
2-Chloro-4,6-dimethoxy-1,3,5-triazine
amide coupling reagent
Piperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride
deuterated research standard compound
3,5-dichloro-4-methylpyridin-2-amine
Research compound
Reychler's acid
resolution of optically active isomers
ethyl 3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15)-tetraene-12-carboxylate
IIOWSVKQLNZUKM-UHFFFAOYSA-N
CCOC(=O)N1CCC2=C(C1)C3=C4N2CC(=O)NC4=CC=C3