Tert-butyl 4-iodopiperidine-1-carboxylate is a chemical compound used as a pharmaceutical intermediate, primarily in the synthesis of active pharmaceutical ingredients. It features a piperidine ring with an iodine substituent and a tert-butyl carbamate protecting group, commonly employed in medicinal chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 301673-14-3
4-N-Boc-2-hydroxymethylpiperazine
Pharmaceutical intermediate
2,5-Dioxopyrrolidin-1-yl N~2~,N~6~-bis(tert-butoxycarbonyl)-L-lysinate
peptide synthesis reagent
N-Fmoc-(2S,5S)-5-tert-butoxypipecolicacid
Pharmaceutical intermediate
(2S,5R)-5-tert-butoxy-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid
pharmaceutical intermediate for peptide synthesis
tert-butyl 4-iodopiperidine-1-carboxylate
YFWQFKUQVJNPKP-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)I