2,3,5-Triphenyltetrazolium chloride is a redox indicator commonly used in biochemical experiments to detect cellular respiration. It appears as a white crystalline powder that is soluble in water, ethanol, and acetone, but insoluble in ether.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 298-96-4
N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)nicotinamide
research compound
2-bromoisonicotinamide
research compound
(1S,2S)-1,2-diphenylethane-1,2-diamine
chiral building block for synthesis
2-Chloro-6-methoxybenzaldehyde
research compound
Iodonitrotetrazolium chloride
Histological dye
Sodium 4-(3-(2-methoxy-4-nitrophenyl)-2-(4-nitrophenyl)-2H-tetrazol-3-ium-5-yl)benzene-1,3-disulfonate
Cell proliferation assay reagent
2,3,5-triphenyltetrazol-2-ium chloride
PKDBCJSWQUOKDO-UHFFFAOYSA-M
C1=CC=C(C=C1)C2=NN([N+](=N2)C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]