This compound is a research reagent designed for conjugation studies, featuring a polyethylene glycol-based structure with multiple amide and ether linkages. Its large, flexible molecular architecture makes computational conformer generation impractical, highlighting its specialized nature for advanced bioconjugation applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2959475-51-3
9-(3-bromophenyl-2,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
3,3'-diselane-1,2-diylbis(2-aminopropanoic acid)
biochemical research reagent
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
(2S)-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]-N-[(2R)-1-[2-[2-[2-[2-[3-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-6-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanamide
HZIKEVLAEMPTBK-HYGNTPKVSA-N
COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)NCCCC[C@@H](C(=O)N[C@@H](CS)C(=O)NCCOCCOCCOCCOCCC(=O)N[C@@H](CS)C(=O)N)NC(=O)CNC(=O)CNC(=O)CN
—