Pachymic acid is a triterpenoid compound that has been reported in Rhodofomitopsis lilacinogilva, Fomitopsis pinicola, and other organisms. It is isolated from the fungus Poria cocos and is known to inhibit phospholipase A2.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 29070-92-6
2-chloro-4,6-diphenylpyrimidine
research compound for chemical synthesis
2,3,6-TRICHLOROPYRIDINE
chemical intermediate for research
2,9-DICHLORO-1,10-PHENANTHROLINE
Research reagent for coordination chemistry
1,2-Diaminobenzene (D4, 98%)
Deuterated internal standard for analytical chemistry
(2R)-2-[(3S,5R,10S,13R,14R,16R,17R)-3-acetyloxy-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid
VDYCLYGKCGVBHN-DRCQUEPLSA-N
CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)C)C)O)C(=O)O