3,5-Dichlorobenzoyl chloride is a chemical compound used as an intermediate in the synthesis of pharmaceutical intermediates. It features a benzene ring with three halogen substituents and a reactive acyl chloride group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2905-62-6
3-Pyridinecarboxamide, 1-ethyl-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-
Pharmaceutical intermediate
N-(2-Oxoethyl)phthalimide
Pharmaceutical intermediate for cyclopyrrolone drugs
(2S)-but-3-yn-2-ol
Chiral building block for synthesis
Fmoc-L-Lys[C20-OtBu-L-Glu(OtBu)-AA-AA]-OH
Pharmaceutical intermediate for peptide synthesis
3,5-dichlorobenzoyl chloride
GGHLXLVPNZMBQR-UHFFFAOYSA-N
C1=C(C=C(C=C1Cl)Cl)C(=O)Cl