This compound is a pharmaceutical intermediate used in the synthesis of NK1 receptor antagonists such as aprepitant. It features a complex stereochemically defined structure with aromatic rings, ether linkages, and halogen substituents, making it a key building block in manufacturing processes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 287930-75-0
Ethyl 8-(2,4-dioxo-2H-1,3-benzoxazin-3(4H)-yl)octanoate
Pharmaceutical intermediate for API synthesis
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
boronic ester pharmaceutical intermediate
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate
Pharmaceutical intermediate for sulfonamide synthesis
BIRG-616 BS
Impurity reference standard for nevirapine
(2R)-4-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]morpholin-3-one
KVPJNHLVRGUYGQ-BFUOFWGJSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2C(=O)N(CCO2)CC3=CC=CC=C3