2-Aminobenzophenone is a chemical compound used primarily as a pharmaceutical intermediate in drug manufacturing. It consists of an aromatic ketone structure with an amino substituent, giving it notable polarity and ring-containing character.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2835-77-0
4-Amino-2-methylphenol
Pharmaceutical intermediate
2-Chloro-N-(4-chloro-2-(2-fluorobenzoyl)phenyl)acetamide
Pharmaceutical intermediate for synthesis
5-amino-2-methylbenzoic acid
Pharmaceutical intermediate compound
3-Amino-4-methoxybenzoic acid
pharmaceutical intermediate
(2-aminophenyl)-phenylmethanone
MAOBFOXLCJIFLV-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N