2,4,6-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid used as a research reagent. Its crystal structure has been reported in the scientific literature, highlighting its role in structural chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 28314-80-9
4-bromo-2,5-difluorobenzoic acid
research compound
5-Hydroxy-1-tetralone
reagent for glucose determination
2-Bromo-9,9-dimethylfluorene
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
2,4,6-trifluorobenzoic acid
SJZATRRXUILGHH-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)O)F)F