Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It is characterized by the presence of an ester group and a trifluoromethyl substituent on a cyclohexane ring, contributing to its role in research and manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 27705-10-8
Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
pharmaceutical intermediate
Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
Pharmaceutical intermediate
[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide
Olopatadine intermediate anti-inflammatory
2-(3,4-dimethylphenyl)-5-methyl-1H-pyrazol-3(2H)-one
Pharmaceutical intermediate
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2,2,2-TRIFLUOROETHYL CHLOROFORMATE
Synthetic intermediate in pharmaceutical chemistry
methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
UKBPRMAOEHOALJ-UHFFFAOYSA-N
COC(=O)C1CCC(CC1)C(F)(F)F
—