1,2,4,5-Cyclohexanetetracarboxylic dianhydride is a bicyclic anhydride compound primarily used as a monomer in the synthesis of polyimide polymers, which are valued for their thermal stability and mechanical properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2754-41-8
3-Oxabicyclo[3.1.0]hexane-2,4-dione
chemical intermediate in organic synthesis
3,3',4,4'-Biphenyltetracarboxylic dianhydride
monomer for polyimide synthesis
[4,5'-Biisobenzofuran]-1,1',3,3'-tetrone
monomer for polyimide synthesis
1,3-Bis(4-aminophenoxy)benzene
monomer for polyimide synthesis
Diisooctyl phthalate
Plasticizer for PVC and resins
1h,1h,2h,2h-perfluorooctanesulfonic acid
surfactant for industrial applications
5-Isoquinolinesulfonic acid
sulfonic acid intermediate
Butane-1,4-disulfonic acid
Industrial sulfonic acid reagent
3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone
LJMPOXUWPWEILS-UHFFFAOYSA-N
C1C2C(CC3C1C(=O)OC3=O)C(=O)OC2=O