[Hydroxy(tosyloxy)iodo]benzene is a hypervalent iodine compound that serves as an oxidizing reagent in organic synthesis. It is characterized by its aromatic rings and a single iodine atom in a hypervalent state, with a molecular weight of approximately 392 g/mol and moderate lipophilicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 27126-76-7
1-Acetoxy-1,2-benziodoxol-3-one
hypervalent iodine oxidizing reagent
[Bis(trifluoroacetoxy)iodo]benzene
hypervalent iodine oxidizing reagent
3,5-Difluorophenol
Research compound for crystallography studies
2,3-Difluorofumaric acid
research compound
3-[(triphenylmethyl)sulfanyl]propanoic acid
Research reagent for peptide synthesis
FURO[2,3-B]PYRIDINE
research compound
[hydroxy(phenyl)-lambda3-iodanyl] 4-methylbenzenesulfonate
LRIUKPUCKCECPT-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OI(C2=CC=CC=C2)O