This compound is a pharmaceutical intermediate, specifically a chlorinated benzothiazepine derivative with a sulfone group. Its structure features two aromatic rings and a heterocyclic ring, contributing to its role in chemical synthesis for pharmaceutical applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 26638-53-9
3,11-dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide
Pharmaceutical intermediate for research
4,4-Dimethyl-1,3-oxazolidin-2-one
pharmaceutical intermediate
N4-Benzoylcytosine
pharmaceutical intermediate for nucleoside synthesis
2-((4-Amino-3-methoxyphenyl)sulphonyl)ethyl hydrogen sulphate
Pharmaceutical intermediate for dye synthesis
3-chloro-6-methyl-5,5-dioxobenzo[c][2,1]benzothiazepin-11-one
RGOFXWXKWORKIP-UHFFFAOYSA-N
CN1C2=CC=CC=C2C(=O)C3=C(S1(=O)=O)C=C(C=C3)Cl