This compound is a fluorinated heterocyclic research reagent featuring a fused furo-chromenone core with stereochemically defined methyl and trifluoromethyl substituents. Its structure includes multiple aromatic rings and halogen atoms, contributing to its potential utility in chemical biology and medicinal chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2649470-79-9
Propyltrimethylammonium bromide
Phase transfer catalyst
Carbonotrithioic acid, bis(phenylmethyl) ester
research compound for RAFT polymerization
(R)-2-(tert-Butyl-dimethyl-silanyloxy)-propan-1-ol
research reagent
2,3-Dihydroxy-N~1~,N~1~,N~4~,N~4~-tetramethylbutanediamide
reference standard for research
(1S,2R)-6,7-difluoro-1,2-dimethyl-2-(trifluoromethyl)-1H-furo[2,3-c]chromen-4-one
HVWSPQLRNJXDCB-VPROBKIXSA-N
C[C@H]1C2=C(C(=O)OC3=C2C=CC(=C3F)F)O[C@@]1(C)C(F)(F)F
—